(R)-(-)-Phenylsuccinic acid
(2R)-2-phenylbutanedioic acid
Also Known As: (R)-(-)-Phenylsuccinic acid|(2R)-2-phenylbutanedioic acid|(R)-2-Phenylsuccinic acid|Phenylsuccinic acid|(R)-2-Phenyl succinic acid|r-phenylsuccinic acid|- -Phenylsuccinicacid|2-Phenylsuccinic acid|(2r)-2-phenylsuccinic acid|2-phenylbutanedioic acid|(R)-phenylsuccinic acid|(R)-2-PHENYLSUCCINICACID|Butanedioic acid, phenyl-, (2R)-|(R)-2-Phenylbutanedioic acid|[R,(-)]-Phenylsuccinic acid|Butanedioic acid, 2-phenyl-, (2R)-|KS-00002BEI|(R)-(-)-2-Phenylsuccinic acid|KST-1A4944|(2R)-2-phenylbutanedioic acid >99% ee|1H-benzimidazole-4-carboxylic acid|Butanedioic acid, phenyl-, (R)-|CP-494|Butanedioic acid,2-phenyl-, (2R)-|SS-4842|K-9071
| Molecular Formula | C10H10O4 |
|---|---|
| Molecular Weight | 194.0579 g/mol |
| LogP | 0.9 |
| Topological Polar Surface Area | 74.6 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 194.0579 |
| Monoisotopic Mass | 194.0579 |
| Heavy Atoms | 14 |
| Complexity | 218.0 |
Chemical Identifiers
| CAS Number | 471-74-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)[C@@H](CC(=O)O)C(=O)O |
| InChIKey | LVFFZQQWIZURIO-MRVPVSSYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(R)-(-)-Phenylsuccinic acid (CAS 471-74-9), with molecular formula C10H10O4 and molecular weight 194.0579 g/mol. IUPAC: (2R)-2-phenylbutanedioic acid.