[2-Oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methylcyclopropane-1-carboxylate
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methylcyclopropane-1-carboxylate
Also Known As: [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methylcyclopropane-1-carboxylate|[2-oxidanylidene-2-[(4-phenyldiazenylphenyl)amino]ethyl] 2-methylcyclopropane-1-carboxylate|2-methyl-1-cyclopropanecarboxylic acid [2-oxo-2-(4-phenyldiazenylanilino)ethyl] ester|2-methylcyclopropanecarboxylic acid [2-keto-2-(4-phenylazoanilino)ethyl] ester|Cyclopropanecarboxylic acid, 2-methyl-, 2-oxo-2-[[4-(2-phenyldiazenyl)phenyl]amino]ethyl ester
| Molecular Formula | C19H19N3O3 |
|---|---|
| Molecular Weight | 337.14264 g/mol |
| LogP | 4.2397 |
| Topological Polar Surface Area | 80.12 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 337.14264 |
| Monoisotopic Mass | 337.14264 |
| Heavy Atoms | 25 |
| Complexity | 772.26117 |
Chemical Identifiers
| CAS Number | 473989-75-2 |
|---|---|
| SMILES | CC1CC1C(=O)OCC(=O)NC2=CC=C(C=C2)N=NC3=CC=CC=C3 |
Product Overview
[2-Oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methylcyclopropane-1-carboxylate (CAS 473989-75-2), with molecular formula C19H19N3O3 and molecular weight 337.14264 g/mol. IUPAC: [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methylcyclopropane-1-carboxylate.