2,2'-Dimethoxybiphenyl-4,4'-diamine
4-(4-amino-2-methoxyphenyl)-3-methoxyaniline
Also Known As: 2,2'-dimethoxybiphenyl-4,4'-diamine|2,2'-dimethoxybenzidine|2,2'-DIMETHOXY-[1,1'-BIPHENYL]-4,4'-DIAMINE|2,2 -Dimethoxybenzidine|Oprea1_640006|4,4'-Diamino-2,2'-dimethoxybiphenyl|4-(4-amino-2-methoxyphenyl)-3-methoxyaniline|2,2'-Dimthoxy-biphenyl-4,4'-diamine|3,3 -Dimethoxy-4,4 -bianiline|2,2 -Dimethoxy-4,4 -biphenyldiamine|2,2 -Dimethoxybiphenyl-4,4 -diamine|2,2'-dimethoxy-1,1'-biphenyl-4,4'-diamine|4-(4-amino-2-methoxy-phenyl)-3-methoxy-aniline|4-(4-amino-2-methoxyphenyl)-3-methoxyphenylamine|AK-968/05740010|2,2'-Dimethoxy[1,1'-biphenyl]-4,4'-diamine #|4'-amino-2,2'-dimethoxy[1,1'-biphenyl]-4-ylamine|2,2 -Dimethoxy-1,1 -biphenyl-4,4 -diamine
| Molecular Formula | C14H16N2O2 |
|---|---|
| Molecular Weight | 244.12119 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 70.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 244.12119 |
| Monoisotopic Mass | 244.12119 |
| Heavy Atoms | 18 |
| Complexity | 236.0 |
Chemical Identifiers
| CAS Number | 4746-75-2 |
|---|---|
| SMILES | COC1=C(C=CC(=C1)N)C2=C(C=C(C=C2)N)OC |
| InChIKey | YJOAIOIVLVUPST-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 16 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,2'-Dimethoxybiphenyl-4,4'-diamine (CAS 4746-75-2), with molecular formula C14H16N2O2 and molecular weight 244.12119 g/mol. IUPAC: 4-(4-amino-2-methoxyphenyl)-3-methoxyaniline.