Gibberellin A1, methyl ester
methyl 5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate
Also Known As: Gibberellin A1, methyl ester|4a,1-(Epoxymethano)-7,9a-methanobenz[a]azulene, gibbane-1,10-diarboxylic acid deriv.|4a.alpha.,4b.beta.-Gibbane-1.alpha.,10.beta.-dicarboxylic acid, 2.beta.,4a,7-trihydroxy-1-methyl-8-m|4a.alpha.,4b.beta.-Gibbane-1.alpha.,10.beta.-dicarboxylic acid, 2.beta.,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, methyl ester|Gibbane-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, 10-methyl est|Gibbane-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, 10-methyl ester, (1.alpha.,2.beta.,4a.alpha.,4b.beta.,10.beta.)-
| Molecular Formula | C20H26O6 |
|---|---|
| Molecular Weight | 362.17294 g/mol |
| LogP | 0.6 |
| Topological Polar Surface Area | 93.1 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Exact Mass | 362.17294 |
| Monoisotopic Mass | 362.17294 |
| Heavy Atoms | 26 |
| Complexity | 747.0 |
Chemical Identifiers
| CAS Number | 4747-53-9 |
|---|---|
| SMILES | CC12C(CCC3(C1C(C45C3CCC(C4)(C(=C)C5)O)C(=O)OC)OC2=O)O |
| InChIKey | OHIXAJDQAXXFTE-UHFFFAOYSA-N |
Product Overview
Gibberellin A1, methyl ester (CAS 4747-53-9), with molecular formula C20H26O6 and molecular weight 362.17294 g/mol. IUPAC: methyl 5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate.