3,5-Dimethyl-4-propyl-1H-pyrrole-2-carboxylic acid ethyl ester
ethyl 3,5-dimethyl-4-propyl-1H-pyrrole-2-carboxylate
Also Known As: Ethyl 3,5-dimethyl-4-propyl-1H-pyrrole-2-carboxylate|3,5-Dimethyl-4-propyl-1H-pyrrole-2-carboxylic acid ethyl ester|2,4-Dimethyl-3-n-propyl-5-carbethoxy-pyrrole|2-ethoxycarbonyl-4-propyl-3,5-di-methylpyrrole|ethyl 3,5-dimethyl-4-propylpyrrole-2-carboxylate|Ethyl 3,5-dimethyl-4-n-propylpyrrole-2-carboxylate|Ethyl 3,5-dimethyl-4-propyl-1H-pyrrole-2-carboxylate #|3,5-dimethyl-4-propyl-pyrrole-2-carboxylic acid ethyl ester|1H-Pyrrole-2-carboxylic acid, 3,5-dimethyl-4-propyl-, ethyl ester
| Molecular Formula | C12H19NO2 |
|---|---|
| Molecular Weight | 209.14159 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 42.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 209.14159 |
| Monoisotopic Mass | 209.14159 |
| Heavy Atoms | 15 |
| Complexity | 218.0 |
Chemical Identifiers
| CAS Number | 4758-64-9 |
|---|---|
| SMILES | CCCC1=C(NC(=C1C)C(=O)OCC)C |
| InChIKey | FURNFZQCOQEXNH-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3,5-Dimethyl-4-propyl-1H-pyrrole-2-carboxylic acid ethyl ester (CAS 4758-64-9), with molecular formula C12H19NO2 and molecular weight 209.14159 g/mol. IUPAC: ethyl 3,5-dimethyl-4-propyl-1H-pyrrole-2-carboxylate.