2-{[(2-fluorophenyl)methyl]sulfanyl}-1H-1,3-benzodiazole
2-[(2-fluorophenyl)methylsulfanyl]-1H-benzimidazole
Also Known As: 2-{[(2-fluorophenyl)methyl]sulfanyl}-1H-1,3-benzodiazole|HS-8511|2-((2-fluorobenzyl)thio)-1H-benzo[d]imidazole|2-[(2-fluorophenyl)methylsulfanyl]-1H-benzimidazole|2-[(2-fluorobenzyl)thio]-1H-benzimidazole|2-[(2-fluorophenyl)methylthio]benzimidazole|2-[(2-fluorobenzyl)sulfanyl]-1H-benzimidazole|2-[(2-fluorophenyl)methylthio]-1H-benzimidazole|F3068-0220|1H-Benzimidazole, 2-[[(2-fluorophenyl)methyl]thio]-|2-[(o-fluorophenyl)methylthio]-1H-1,3-benzimidazole
| Molecular Formula | C14H11FN2S |
|---|---|
| Molecular Weight | 258.06268 g/mol |
| LogP | 3.9943 |
| Topological Polar Surface Area | 28.68 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 258.06268 |
| Monoisotopic Mass | 258.06268 |
| Heavy Atoms | 18 |
| Complexity | 645.12054 |
Chemical Identifiers
| CAS Number | 475977-75-4 |
|---|---|
| SMILES | C1=CC=C(C(=C1)CSC2=NC3=CC=CC=C3N2)F |
Product Overview
2-{[(2-fluorophenyl)methyl]sulfanyl}-1H-1,3-benzodiazole (CAS 475977-75-4), with molecular formula C14H11FN2S and molecular weight 258.06268 g/mol. IUPAC: 2-[(2-fluorophenyl)methylsulfanyl]-1H-benzimidazole.
2-{[(2-fluorophenyl)methyl]sulfanyl}-1H-1,3-benzodiazole is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »