AC1MQ3FT
N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-2-thiophen-2-ylquinoline-4-carboxamide
Also Known As: Oprea1_664888|AB00672322-01|F0737-0003|N-(7-methylbenzo[1,2-d:3,4-d']bis(thiazole)-2-yl)-2-(thiophen-2-yl)quinoline-4-carboxamide|N-{11-methyl-3,10-dithia-5,12-diazatricyclo[7.3.0.0^{2,6}]dodeca-1(9),2(6),4,7,11-pentaen-4-yl}-2-(thiophen-2-yl)quinoline-4-carboxamide|N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-2-thiophen-2-ylquinoline-4-carboxamide|N-(7-methyl-1,6-dithia-3,8-diaza-as-indacen-2-yl)-2-(2-thienyl)-4-quinolinecarboxamide
| Molecular Formula | C23H14N4OS3 |
|---|---|
| Molecular Weight | 458.033 g/mol |
| LogP | 6.74342 |
| Topological Polar Surface Area | 67.77 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Exact Mass | 458.033 |
| Monoisotopic Mass | 458.033 |
| Heavy Atoms | 31 |
| Complexity | 1598.132 |
Chemical Identifiers
| CAS Number | 476641-03-9 |
|---|---|
| SMILES | CC1=NC2=C(S1)C=CC3=C2SC(=N3)NC(=O)C4=CC(=NC5=CC=CC=C54)C6=CC=CS6 |
Product Overview
AC1MQ3FT (CAS 476641-03-9), with molecular formula C23H14N4OS3 and molecular weight 458.033 g/mol. IUPAC: N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-2-thiophen-2-ylquinoline-4-carboxamide.