Ogen
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate;piperazine
Also Known As: Estropipate|Ogen|Piperazine estrone sulfate|Harmogen|Sulestrex|Ortho-Est|Harmonet|Genoral|Sulestrex piperazine|Piperazine estronesulfate|Estropipate (USP)|Estropipate [USAN]|piperazine estrone sulphate|OGEN 5|Ogen (TN)|Piperazineestronesulfate|Estrone sulfate piperazine salt|Estropipate (Standard)|OGEN 2.5|Estrone sulphate piperazine|Estropipate [USP:INN:BAN]|ESTROPIPATE [VANDF]|OGEN .625|OGEN 1.25|Piperazine oestrone sulphate|ESTROPIPATE [MART.]|ESTROPIPATE [USP-RS]|ESTROPIPATE [WHO-DD]|EINECS 230-696-3|ERK5-3E22|HY-B1361R|ESTROPIPATE [ORANGE BOOK]
| Molecular Formula | C22H32N2O5S |
|---|---|
| Molecular Weight | 436.2032 g/mol |
| LogP | 2.4726 |
| Topological Polar Surface Area | 104.73 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Exact Mass | 436.2032 |
| Monoisotopic Mass | 436.2032 |
| Heavy Atoms | 30 |
| Complexity | 887.27924 |
Chemical Identifiers
| CAS Number | 477-24-7 |
|---|---|
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OS(=O)(=O)O.C1CNCCN1 |
Product Overview
Ogen (CAS 477-24-7), with molecular formula C22H32N2O5S and molecular weight 436.2032 g/mol. IUPAC: [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate;piperazine.