4-{[(4-Bromophenyl)sulfanyl]methyl}-1-[(4-chlorophenyl)sulfonyl]-4-piperidinol
4-[(4-bromophenyl)sulfanylmethyl]-1-(4-chlorophenyl)sulfonylpiperidin-4-ol
Also Known As: Oprea1_081038|KS-000036MK|4-{[(4-bromophenyl)sulfanyl]methyl}-1-[(4-chlorophenyl)sulfonyl]-4-piperidinol|3R-1086|4-[(4-bromophenyl)sulfanylmethyl]-1-(4-chlorophenyl)sulfonylpiperidin-4-ol|4-{[(4-bromophenyl)sulfanyl]methyl}-1-(4-chlorobenzenesulfonyl)piperidin-4-ol|4-[(4-bromophenyl)sulfanylmethyl]-1-(4-chlorophenyl)sulfonyl-piperidin-4-ol
| Molecular Formula | C18H19BrClNO3S2 |
|---|---|
| Molecular Weight | 474.96783 g/mol |
| LogP | 4.4104 |
| Topological Polar Surface Area | 57.61 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 474.96783 |
| Monoisotopic Mass | 474.96783 |
| Heavy Atoms | 26 |
| Complexity | 849.0099 |
Chemical Identifiers
| CAS Number | 478041-70-2 |
|---|---|
| SMILES | C1CN(CCC1(CSC2=CC=C(C=C2)Br)O)S(=O)(=O)C3=CC=C(C=C3)Cl |
Product Overview
4-{[(4-Bromophenyl)sulfanyl]methyl}-1-[(4-chlorophenyl)sulfonyl]-4-piperidinol (CAS 478041-70-2), with molecular formula C18H19BrClNO3S2 and molecular weight 474.96783 g/mol. IUPAC: 4-[(4-bromophenyl)sulfanylmethyl]-1-(4-chlorophenyl)sulfonylpiperidin-4-ol.
4-{[(4-Bromophenyl)sulfanyl]methyl}-1-[(4-chlorophenyl)sulfonyl]-4-piperidinol is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »