AC1NZVP0
[2-[(4-methylphenyl)methylsulfanyl]-1H-indol-3-yl]-[3-(trifluoromethyl)phenyl]diazene
Also Known As: 4P-329S|2-[(4-methylbenzyl)sulfanyl]-3H-indol-3-one N-[3-(trifluoromethyl)phenyl]hydrazone|(3Z)-2-{[(4-methylphenyl)methyl]sulfanyl}-3-{2-[3-(trifluoromethyl)phenyl]hydrazin-1-ylidene}-3H-indole|[2-[(4-methylphenyl)methylsulfanyl]-1H-indol-3-yl]-[3-(trifluoromethyl)phenyl]diazene|N-[[2-[(4-methylphenyl)methylsulfanyl]indol-3-ylidene]amino]-3-(trifluoromethyl)aniline|N-[(Z)-[2-[(4-methylphenyl)methylsulfanyl]indol-3-ylidene]amino]-3-(trifluoromethyl)aniline
| Molecular Formula | C23H18F3N3S |
|---|---|
| Molecular Weight | 425.11734 g/mol |
| LogP | 8.20282 |
| Topological Polar Surface Area | 40.51 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 425.11734 |
| Monoisotopic Mass | 425.11734 |
| Heavy Atoms | 30 |
| Complexity | 1194.5206 |
Chemical Identifiers
| CAS Number | 478043-97-9 |
|---|---|
| SMILES | CC1=CC=C(C=C1)CSC2=C(C3=CC=CC=C3N2)N=NC4=CC=CC(=C4)C(F)(F)F |
Product Overview
AC1NZVP0 (CAS 478043-97-9), with molecular formula C23H18F3N3S and molecular weight 425.11734 g/mol. IUPAC: [2-[(4-methylphenyl)methylsulfanyl]-1H-indol-3-yl]-[3-(trifluoromethyl)phenyl]diazene.