ST029264
2-tert-butyl-6-[2-(3-tert-butyl-2-hydroxy-5-methylphenyl)propan-2-yl]-4-methylphenol
Also Known As: Phenol, 2,2'-(1-methylethylidene)bis[6-(1,1-dimethylethyl)-4-methyl-|2-tert-butyl-6-[2-(3-tert-butyl-2-hydroxy-5-methylphenyl)propan-2-yl]-4-methylphenol|2,2-bis-(2-hydroxy-5-methyl-3-t-butylphenyl)propane|2,2'-propane-2,2-diylbis(6-tert-butyl-4-methylphenol)|2,2'-(Propane-2,2-diyl)bis(6-tert-butyl-4-methylphenol)|6,6'-di-tert-butyl-4,4'-dimethyl-2,2'-isopropylidene-di-phenol|6-(tert-butyl)-2-{1-[3-(tert-butyl)-2-hydroxy-5-methylphenyl]-isopropyl}-4-met hylphenol
| Molecular Formula | C25H36O2 |
|---|---|
| Molecular Weight | 368.27155 g/mol |
| LogP | 6.63554 |
| Topological Polar Surface Area | 40.46 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 368.27155 |
| Monoisotopic Mass | 368.27155 |
| Heavy Atoms | 27 |
| Complexity | 787.85846 |
Chemical Identifiers
| CAS Number | 4809-85-2 |
|---|---|
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C2=CC(=CC(=C2O)C(C)(C)C)C)O)C(C)(C)C |
Product Overview
ST029264 (CAS 4809-85-2), with molecular formula C25H36O2 and molecular weight 368.27155 g/mol. IUPAC: 2-tert-butyl-6-[2-(3-tert-butyl-2-hydroxy-5-methylphenyl)propan-2-yl]-4-methylphenol.