2,3,4,5,6-Pentamethylbenzyl alcohol
(2,3,4,5,6-pentamethylphenyl)methanol
Also Known As: 2,3,4,5,6-Pentamethylbenzyl alcohol|(2,3,4,5,6-pentamethylphenyl)methanol|Beta-Aspartame|ACMC-20aoix|pentamethylbenzyl alcohol|pentamethylphenyl-methanol|Maybridge1_002919|(PENTAMETHYLPHENYL)METHANOL|DivK1c_001671|EINECS 207-609-2|HMS549M15|CDS1_000631|2,3,4,5,6-Pentamethyl benzyl alcohol|FC1065|2,3,4,5,6-Pentamethylbenzylalcohol|2,3,4,5,6-Pentamethylbenzenemethanol|Benzenemethanol,2,3,4,5,6-pentamethyl-|CD 02784|(2,3,4,5,6-pentamethyl-phenyl)-methanol|Benzenemethanol, 2,3,4,5,6-pentamethyl-|(2,3,4,5,6-pentamethylphenyl)methan-1-ol|2,3,4,5,6-Pentamethylbenzyl alcohol, 99%|I01-0216
| Molecular Formula | C12H18O |
|---|---|
| Molecular Weight | 178.13577 g/mol |
| LogP | 2.721 |
| Topological Polar Surface Area | 20.23 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 178.13577 |
| Monoisotopic Mass | 178.13577 |
| Heavy Atoms | 13 |
| Complexity | 308.4631 |
Chemical Identifiers
| CAS Number | 484-66-2 |
|---|---|
| SMILES | CC1=C(C(=C(C(=C1C)C)CO)C)C |
Product Overview
2,3,4,5,6-Pentamethylbenzyl alcohol (CAS 484-66-2), with molecular formula C12H18O and molecular weight 178.13577 g/mol. IUPAC: (2,3,4,5,6-pentamethylphenyl)methanol.