3-(Diethylamino)propyl 2-ethyl-2-methylhexanoate--hydrogen chloride (1/1)
3-(diethylamino)propyl 2-ethyl-2-methylhexanoate;hydrochloride
Also Known As: Diethylaminopropyl 2-ethyl-2-methylhexanoate hydrochloride|4,6-Diphenyl-2-(2,4-dihydroxyphenyl)-s-triazine|3-(diethylamino)propyl 2-ethyl-2-methylhexanoate hydrochloride(1:1)|3-(diethylamino)propyl 2-ethyl-2-methylhexanoate hydrochloride|3-(Diethylamino)propyl 2-ethyl-2-methylhexanoate--hydrogen chloride (1/1)|Hexanoic acid, 2-ethyl-2-methyl-, 3-(diethylamino)propyl ester, hydrochloride|5,11-dihydroperoxy-5-hydroxy-54,64,113-tridecaoxidan-6-one compound with hydrogen peroxide (1:1)
| Molecular Formula | C16H34ClNO2 |
|---|---|
| Molecular Weight | 307.2278 g/mol |
| LogP | 4.2898 |
| Topological Polar Surface Area | 29.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Exact Mass | 307.2278 |
| Monoisotopic Mass | 307.2278 |
| Heavy Atoms | 20 |
| Complexity | 239.0 |
Chemical Identifiers
| CAS Number | 4847-94-3 |
|---|---|
| SMILES | CCCCC(C)(CC)C(=O)OCCCN(CC)CC.Cl |
| InChIKey | USIIGLVAVCCXCS-UHFFFAOYSA-N |
Product Overview
3-(Diethylamino)propyl 2-ethyl-2-methylhexanoate--hydrogen chloride (1/1) (CAS 4847-94-3), with molecular formula C16H34ClNO2 and molecular weight 307.2278 g/mol. IUPAC: 3-(diethylamino)propyl 2-ethyl-2-methylhexanoate;hydrochloride.
3-(Diethylamino)propyl 2-ethyl-2-methylhexanoate--hydrogen chloride (1/1) is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »