Syringaresinol, (+)-
4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-dimethoxyphenol
Also Known As: (+)-Syringaresinol|Syringaresinol|DL-Syringaresinol|(+)-lirioresinol B|syringarenol|syringresinol|Lirioresinol b|(-) Syringaresinol|(+/-)-Syringaresinol|Syringaresinol, (+)-|(-)-syringaresinol|Syringaresinol, (+/-)-|(+)-Syringaresinol, 98%|(? currency)-Syringaresinol|NP4157|TN1594|TN2249|(-)-(7R,8S,7'R,8'S)-syringaresinol
| Molecular Formula | C22H26O8 |
|---|---|
| Molecular Weight | 418.16278 g/mol |
| LogP | 2.2 |
| Topological Polar Surface Area | 95.8 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Exact Mass | 418.16278 |
| Monoisotopic Mass | 418.16278 |
| Heavy Atoms | 30 |
| Complexity | 485.0 |
Chemical Identifiers
| CAS Number | 487-35-4 |
|---|---|
| SMILES | COC1=CC(=CC(=C1O)OC)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C(=C4)OC)O)OC |
| InChIKey | KOWMJRJXZMEZLD-HCIHMXRSSA-N |
Patent-Derived Application Labels
Derived from 11 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Syringaresinol, (+)- (CAS 487-35-4), with molecular formula C22H26O8 and molecular weight 418.16278 g/mol. IUPAC: 4-[(3S,3aR,6S,6aR)-6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-dimethoxyphenol.