2,5-Dimethyl furan-2,5-dicarboxylate
dimethyl furan-2,5-dicarboxylate
Also Known As: dimethyl furan-2,5-dicarboxylate|2, dimethyl ester|Dimethyl 2,5-furandicarboxylate|2,5-dimethyl furan-2,5-dicarboxylate|DimethylFuran-2,5-dicarboxylate|Methyl Furan-2,5-dicarboxylate|2,5-Bis(methoxycarbonyl)furan|2,5-Furandicarboxylic acid, dimethyl ester|dimethyl furan 2,5-dicarboxylate|2,5-Furandicarboxylic acid dimethyl ester|Dimethyl Furan-2,5-dicarboxylate|KS-00000I7N|furan-2,5-dicarboxylic acid dimethyl ester|CD-350|2-Propionic-3-Methylmaleic Anhydride|CS-W018613
| Molecular Formula | C8H8O5 |
|---|---|
| Molecular Weight | 184.03717 g/mol |
| LogP | 1.0 |
| Topological Polar Surface Area | 65.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 184.03717 |
| Monoisotopic Mass | 184.03717 |
| Heavy Atoms | 13 |
| Complexity | 191.0 |
Chemical Identifiers
| CAS Number | 487-66-1 |
|---|---|
| SMILES | COC(=O)C1=CC=C(O1)C(=O)OC |
| InChIKey | UWQOPFRNDNVUOA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,5-Dimethyl furan-2,5-dicarboxylate (CAS 487-66-1), with molecular formula C8H8O5 and molecular weight 184.03717 g/mol. IUPAC: dimethyl furan-2,5-dicarboxylate.