4,5-Dimethoxy-2-methylphenyl methyl sulphone
1,2-dimethoxy-4-methyl-5-methylsulfonylbenzene
Also Known As: 4,5-Dimethoxy-2-methylphenyl methyl sulphone|4,5-dimethoxy-2-methylphenyl methyl sulfone|RX 71112|4,5-dimethoxy-2-methylphenylmethylsulphone|1,2-dimethoxy-4-methyl-5-methylsulfonylbenzene|(4,5-dimethoxy-2-methyl-phenyl)-methylsulphone|1,2-dimethoxy-4-methyl-5-(methylsulfonyl)benzene|1-(Methanesulfonyl)-4,5-dimethoxy-2-methylbenzene|Benzene, 1,2-dimethoxy-4-methyl-5-(methylsulfonyl)-
| Molecular Formula | C10H14O4S |
|---|---|
| Molecular Weight | 230.06128 g/mol |
| LogP | 1.5 |
| Topological Polar Surface Area | 61.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 230.06128 |
| Monoisotopic Mass | 230.06128 |
| Heavy Atoms | 15 |
| Complexity | 293.0 |
Chemical Identifiers
| CAS Number | 4873-41-0 |
|---|---|
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)C)OC)OC |
| InChIKey | BDSQTUZWUIXSNF-UHFFFAOYSA-N |
Product Overview
4,5-Dimethoxy-2-methylphenyl methyl sulphone (CAS 4873-41-0), with molecular formula C10H14O4S and molecular weight 230.06128 g/mol. IUPAC: 1,2-dimethoxy-4-methyl-5-methylsulfonylbenzene.
4,5-Dimethoxy-2-methylphenyl methyl sulphone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »