1,2-Dichloro-4-methylsulfonylbenzene
1,2-dichloro-4-methylsulfonylbenzene
Also Known As: 1,2-dichloro-4-(methylsulfonyl)benzene|1,2-dichloro-4-methylsulfonylbenzene|3,4-dichlorophenyl methyl sulfone|3,4-Dichlorophenylmethylsulfone|Enamine_004791|ACMC-1AJ7X|1,2-Dichloro-4-(methylsulphonyl)benzene|Benzene, 1,2-dichloro-4-(methylsulfonyl)-|1,2-dichloro-4-methanesulfonylbenzene|1,2-DICHLORO-4- BENZENE|methyl-(3,4-dichlorophenyl)sulphone|FS-3904|1,2-Dichloro-4-(methanesulfonyl)benzene|1,2-DICHLORO-4-METHYLSULPHONYLBENZENE
| Molecular Formula | C7H6Cl2O2S |
|---|---|
| Molecular Weight | 223.94655 g/mol |
| LogP | 2.6 |
| Topological Polar Surface Area | 42.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 223.94655 |
| Monoisotopic Mass | 223.94655 |
| Heavy Atoms | 12 |
| Complexity | 245.0 |
Chemical Identifiers
| CAS Number | 4874-30-0 |
|---|---|
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)Cl)Cl |
| InChIKey | DNWUINQASFDJJS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
1,2-Dichloro-4-methylsulfonylbenzene (CAS 4874-30-0), with molecular formula C7H6Cl2O2S and molecular weight 223.94655 g/mol. IUPAC: 1,2-dichloro-4-methylsulfonylbenzene.
1,2-Dichloro-4-methylsulfonylbenzene is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »