![2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-ethyl-6-iodoquinazolin-4(3H)-one structure](/static/products/488/488087-76-9.png)
2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-ethyl-6-iodoquinazolin-4(3H)-one
2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-ethyl-6-iodoquinazolin-4-one
Also Known As: 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-ethyl-6-iodoquinazolin-4-one|2-((2-(4-chlorophenyl)-2-oxoethyl)thio)-3-ethyl-6-iodoquinazolin-4(3H)-one|2-[2-(4-chlorophenyl)-2-oxo-ethyl]sulfanyl-3-ethyl-6-iodo-quinazolin-4-one|2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-ethyl-6-iodoquinazolin-4(3H)-one
| Molecular Formula | C18H14ClIN2O2S |
|---|---|
| Molecular Weight | 483.95093 g/mol |
| LogP | 4.6494 |
| Topological Polar Surface Area | 51.96 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 483.95093 |
| Monoisotopic Mass | 483.95093 |
| Heavy Atoms | 25 |
| Complexity | 1002.36896 |
Chemical Identifiers
| CAS Number | 488087-76-9 |
|---|---|
| SMILES | CCN1C(=O)C2=C(C=CC(=C2)I)N=C1SCC(=O)C3=CC=C(C=C3)Cl |
Product Overview
2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-ethyl-6-iodoquinazolin-4(3H)-one (CAS 488087-76-9), with molecular formula C18H14ClIN2O2S and molecular weight 483.95093 g/mol. IUPAC: 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-ethyl-6-iodoquinazolin-4-one.
2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-3-ethyl-6-iodoquinazolin-4(3H)-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »