C30H27N5OS
2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide
Also Known As: 2-{[4,5-bis(4-methylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N'-[(1E)-1-(naphthalen-1-yl)ethylidene]acetohydrazide|(E)-2-((4,5-di-p-tolyl-4H-1,2,4-triazol-3-yl)thio)-N'-(1-(naphthalen-1-yl)ethylidene)acetohydrazide|2-{[4,5-bis(4-methylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N'-[(E)-1-(1-naphthyl)ethylidene]acetohydrazide|N-((1E)-2-naphthyl-1-azaprop-1-enyl)-2-[4,5-bis(4-methylphenyl)(1,2,4-triazol- 3-ylthio)]acetamide
| Molecular Formula | C30H27N5OS |
|---|---|
| Molecular Weight | 505.19363 g/mol |
| LogP | 6.33684 |
| Topological Polar Surface Area | 72.17 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Exact Mass | 505.19363 |
| Monoisotopic Mass | 505.19363 |
| Heavy Atoms | 37 |
| Complexity | 1581.9464 |
Chemical Identifiers
| CAS Number | 488129-99-3 |
|---|---|
| SMILES | CC1=CC=C(C=C1)C2=NN=C(N2C3=CC=C(C=C3)C)SCC(=O)N/N=C(\C)/C4=CC=CC5=CC=CC=C54 |
Product Overview
C30H27N5OS (CAS 488129-99-3), with molecular formula C30H27N5OS and molecular weight 505.19363 g/mol. IUPAC: 2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-1-naphthalen-1-ylethylideneamino]acetamide.