![methyl 3-{[(4-methoxyphenyl)carbamoyl]amino}-5-methyl-1H-indole-2-carboxylate structure](/static/products/488/488135-69-9.png)
methyl 3-{[(4-methoxyphenyl)carbamoyl]amino}-5-methyl-1H-indole-2-carboxylate
methyl 3-[(4-methoxyphenyl)carbamoylamino]-5-methyl-1H-indole-2-carboxylate
Also Known As: methyl 3-(3-(4-methoxyphenyl)ureido)-5-methyl-1H-indole-2-carboxylate|3-[3-(4-Methoxy-phenyl)-ureido]-5-methyl-1H-indole-2-carboxylic acid methyl ester|methyl 3-[(4-methoxyphenyl)carbamoylamino]-5-methyl-1H-indole-2-carboxylate|methyl 3-{[(4-methoxyphenyl)carbamoyl]amino}-5-methyl-1H-indole-2-carboxylate
| Molecular Formula | C19H19N3O4 |
|---|---|
| Molecular Weight | 353.13754 g/mol |
| LogP | 3.91552 |
| Topological Polar Surface Area | 92.45 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 353.13754 |
| Monoisotopic Mass | 353.13754 |
| Heavy Atoms | 26 |
| Complexity | 960.8247 |
Chemical Identifiers
| CAS Number | 488135-69-9 |
|---|---|
| SMILES | CC1=CC2=C(C=C1)NC(=C2NC(=O)NC3=CC=C(C=C3)OC)C(=O)OC |
Product Overview
methyl 3-{[(4-methoxyphenyl)carbamoyl]amino}-5-methyl-1H-indole-2-carboxylate (CAS 488135-69-9), with molecular formula C19H19N3O4 and molecular weight 353.13754 g/mol. IUPAC: methyl 3-[(4-methoxyphenyl)carbamoylamino]-5-methyl-1H-indole-2-carboxylate.
methyl 3-{[(4-methoxyphenyl)carbamoyl]amino}-5-methyl-1H-indole-2-carboxylate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »