AC1OAKOA
3-(furan-2-yl)-4-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione
Also Known As: SR-01000253800-1|3-(furan-2-yl)-4-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione|(E)-5-(furan-2-yl)-4-((2,3,4-trimethoxybenzylidene)amino)-4H-1,2,4-triazole-3-thiol|4-[(1E)-2-(2,3,4-trimethoxyphenyl)-1-azavinyl]-5-(2-furyl)-1,2,4-triazole-3-th iol|5-(2-FURYL)-4-((2,3,4-TRIMETHOXYBENZYLIDENE)AMINO)-4H-1,2,4-TRIAZOLE-3-THIOL|5-(furan-2-yl)-4-{[(E)-(2,3,4-trimethoxyphenyl)methylidene]amino}-2,4-dihydro-3H-1,2,4-triazole-3-thione
| Molecular Formula | C16H16N4O4S |
|---|---|
| Molecular Weight | 360.08923 g/mol |
| LogP | 3.10869 |
| Topological Polar Surface Area | 86.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Exact Mass | 360.08923 |
| Monoisotopic Mass | 360.08923 |
| Heavy Atoms | 25 |
| Complexity | 943.69806 |
Chemical Identifiers
| CAS Number | 488796-91-4 |
|---|---|
| SMILES | COC1=C(C(=C(C=C1)/C=N/N2C(=NNC2=S)C3=CC=CO3)OC)OC |
Product Overview
AC1OAKOA (CAS 488796-91-4), with molecular formula C16H16N4O4S and molecular weight 360.08923 g/mol. IUPAC: 3-(furan-2-yl)-4-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.