![2,5-Bis(4-chlorophenyl)-7-phenyl-3,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine structure](/static/products/489/489443-72-3.png)
2,5-Bis(4-chlorophenyl)-7-phenyl-3,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine
2,5-bis(4-chlorophenyl)-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine
Also Known As: 2,5-bis(4-chlorophenyl)-7-phenyl-1,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine|2,5-bis(4-chlorophenyl)-7-phenyl-3,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine|2,5-bis(4-chlorophenyl)-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine
| Molecular Formula | C23H16Cl2N4 |
|---|---|
| Molecular Weight | 418.0752 g/mol |
| LogP | 6.3079 |
| Topological Polar Surface Area | 42.74 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 418.0752 |
| Monoisotopic Mass | 418.0752 |
| Heavy Atoms | 29 |
| Complexity | 1180.0471 |
Chemical Identifiers
| CAS Number | 489443-72-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2C=C(NC3=NC(=NN23)C4=CC=C(C=C4)Cl)C5=CC=C(C=C5)Cl |
Product Overview
2,5-Bis(4-chlorophenyl)-7-phenyl-3,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine (CAS 489443-72-3), with molecular formula C23H16Cl2N4 and molecular weight 418.0752 g/mol. IUPAC: 2,5-bis(4-chlorophenyl)-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
2,5-Bis(4-chlorophenyl)-7-phenyl-3,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »