Glycine-d5
deuterio 2,2-dideuterio-2-(dideuterioamino)acetate
Also Known As: Glycine-d5|(2H5)Glycine|perdeuterioglycine|perdeuteroglycine|glycine|pentadeuteroglycine|Aciport-d5|Deuterated glycine|Aminoacetic Acid-d5|pentadeuterioglycine|Glycosthene-d5|Glycolixir-d5|Glicoamin-d5|Glycocoll-d5|Gyn-Hydralin-d5|Glycine D5|Padil-d5|((2)H5)glycine|Glycine-[d5]|Glycine-N,N,1,2,2-d5|EINECS 225-518-6|Glycine-d5, 98 atom % D|deuterio 2,2-dideuterio-2-(dideuterioamino)acetate|MSK1408D5|TMID-0939|(O,N,N,2,2-2H5)Glycine|NSC 2916-d5|HY-Y0966S8|NSC 25936-d5|NSC 54188-d5|CS-T-55422|2-[(?H?)amino](?H?)ethan(?H)oic acid|2-[(2H2)amino](2H2)ethan(2H)oic acid
| Molecular Formula | C2H5NO2 |
|---|---|
| Molecular Weight | 80.063416 g/mol |
| LogP | -0.9703 |
| Topological Polar Surface Area | 63.32 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 80.063416 |
| Monoisotopic Mass | 80.063416 |
| Heavy Atoms | 5 |
| Complexity | 135.60963 |
Chemical Identifiers
| CAS Number | 4896-77-9 |
|---|---|
| SMILES | [2H]C([2H])(C(=O)O[2H])N([2H])[2H] |
Product Overview
Glycine-d5 (CAS 4896-77-9), with molecular formula C2H5NO2 and molecular weight 80.063416 g/mol. IUPAC: deuterio 2,2-dideuterio-2-(dideuterioamino)acetate.
Glycine-d5 is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »