Phloroglucide
2-(3,5-dihydroxyphenyl)benzene-1,3,5-triol
Also Known As: Phloroglucide|phloroglucid|phloroglucidol|Ethylferrocene|Phloroglucide hydrate|2,3',4,5',6-Biphenylpentol|[1,1'-Biphenyl]-2,3',4,5',6-pentaol|2-(3,5-dihydroxyphenyl)benzene-1,3,5-triol|Phloroglucinol Impurity D|Phloroglucinol Impurity 18|[1,1'-Biphenyl]-2,3',4,5',6-pentol|NCIOpen2_003126|2,4,5',6-Biphenylpentol|Phloroglucinol EP Impurity D|2,4,6,3',5'-biphenylpentol|(1,1'-Biphenyl)-2,3',4,5',6-pentol|Biphenyl-2,3,4,5,6-pentaol|biphenyl-2,3',4,5',6-pentol|Biphenyl-2,3',4,5',6-pentaol|Biphenyl-2,3?,4,5?,6-pentaol|TN7762|ZB1044|2,3',4,5',6-Pentahydroxybiphenyl
| Molecular Formula | C12H10O5 |
|---|---|
| Molecular Weight | 234.05283 g/mol |
| LogP | 1.8 |
| Topological Polar Surface Area | 101.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 234.05283 |
| Monoisotopic Mass | 234.05283 |
| Heavy Atoms | 17 |
| Complexity | 237.0 |
Chemical Identifiers
| CAS Number | 491-45-2 |
|---|---|
| SMILES | C1=C(C=C(C=C1O)O)C2=C(C=C(C=C2O)O)O |
| InChIKey | KICYRZIVKKYRFS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Phloroglucide (CAS 491-45-2), with molecular formula C12H10O5 and molecular weight 234.05283 g/mol. IUPAC: 2-(3,5-dihydroxyphenyl)benzene-1,3,5-triol.