Olivetolic Acid
2,4-dihydroxy-6-pentylbenzoic acid
Also Known As: Olivetolic acid|2,4-Dihydroxy-6-pentylbenzoic acid|Olivetolate|Olivetolcarboxylic acid|Allazetolcarboxylic acid|olivetolicacid|6-pentyl-beta-resorcylic acid|benzoic acid, 2,4-dihydroxy-6-pentyl-|beta-Resorcyclic acid, 6-pentyl-|2,4-Dihydroxy-6-pentyl-benzoic acid|2,4-dihydroxy-6-pentylbenzoate|6-Pentyl-| cent-Resorcylic Acid|2-Amyl-4,6-dihydroxy-benzoic acid|2-Pentyl-4,6-dihydroxybenzoic acid|TN7252|2,4-Bis(Oxidanyl)-6-Pentyl-Benzoic Acid|HY-W090292|Olivetolic acid 100 microg/mL in Methanol|Olivetolic acid 1000 microg/mL in Methanol|Olivetolic acid 1000 |Ig/mL in Methanol|beta-Resorcylic acid, 6-pentyl- (7CI,8CI)
| Molecular Formula | C12H16O4 |
|---|---|
| Molecular Weight | 224.10486 g/mol |
| LogP | 2.5287 |
| Topological Polar Surface Area | 77.76 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 224.10486 |
| Monoisotopic Mass | 224.10486 |
| Heavy Atoms | 16 |
| Complexity | 384.8503 |
Chemical Identifiers
| CAS Number | 491-72-5 |
|---|---|
| SMILES | CCCCCC1=C(C(=CC(=C1)O)O)C(=O)O |
Product Overview
Olivetolic Acid (CAS 491-72-5), with molecular formula C12H16O4 and molecular weight 224.10486 g/mol. IUPAC: 2,4-dihydroxy-6-pentylbenzoic acid.