Biochanin A
5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one
Also Known As: biochanin A|Biochanin|4'-Methylgenistein|olmelin|Pratensol|Biochanine A|5,7-Dihydroxy-4'-methoxyisoflavone|Biochanin-A|4-Methylgenistein|BiochaninA|Genistein 4-methyl ether|abiochanin A|Not Available|Pratensol;|5,7-Dihydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one|Biochanin A, 9|5,7-Dihydrox -4'-methoxyisoflavone|Biochanin A (Standard)|Biochanin A (BCA)|Biochanin A (BIO)|4 -Methylgenistein|5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one|Spectrum_000195|Genistein 4'-methyl ether|Genistein 4-Methylether|Apigenin 4-Methyl Ether|Spectrum2_000047|Spectrum3_001098|Spectrum4_001927|Spectrum5_001624|Biochanin A [WHO-DD]|BIOCHANIN A [MI]|Epitope ID:613419|biochanin A, 14C-labeled|4-Methylgenistein(Standard)
| Molecular Formula | C16H12O5 |
|---|---|
| Molecular Weight | 284.06848 g/mol |
| LogP | 2.8798 |
| Topological Polar Surface Area | 79.9 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 284.06848 |
| Monoisotopic Mass | 284.06848 |
| Heavy Atoms | 21 |
| Complexity | 862.21 |
Chemical Identifiers
| CAS Number | 491-80-5 |
|---|---|
| SMILES | COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O |
Product Overview
Biochanin A (CAS 491-80-5), with molecular formula C16H12O5 and molecular weight 284.06848 g/mol. IUPAC: 5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one.