Tropine isobutyrate
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-methylpropanoate
Also Known As: Tropine isobutyrate|Butropine|Iisobutyroyl tropine|3a-isobutyryloxytropane|3.alpha.-Isobutyroxytropane|3-beta-isobutyryloxy tropane|[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-methylpropanoate|endo-8-Methyl-8-azabicylco(3.2.1)oct-3-yl 2-methylpropanoate|(1R,5S)-8-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-YL 2-METHYLPROPANOATE|(1R,3s,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl isobutyrate|Propanoic acid, 2-methyl-, 8-methyl-8-azabicyclo(3.2.1)oct-3-yl ester, endo-|(1R,3S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl 2-methylpropanoate|2-Methylpropanoic acid (1R,5S,8-syn)-8-methyl-8-azabicyclo[3.2.1]octan-3alpha-yl ester
| Molecular Formula | C12H21NO2 |
|---|---|
| Molecular Weight | 211.15723 g/mol |
| LogP | 1.8108 |
| Topological Polar Surface Area | 29.54 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 211.15723 |
| Monoisotopic Mass | 211.15723 |
| Heavy Atoms | 15 |
| Complexity | 238.00667 |
Chemical Identifiers
| CAS Number | 495-80-7 |
|---|---|
| SMILES | CC(C)C(=O)OC1C[C@H]2CC[C@@H](C1)N2C |
Product Overview
Tropine isobutyrate (CAS 495-80-7), with molecular formula C12H21NO2 and molecular weight 211.15723 g/mol. IUPAC: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-methylpropanoate.