3,5-Difluoro-2-methoxyphenylboronic acid
(3,5-difluoro-2-methoxyphenyl)boronic acid
Also Known As: (3,5-difluoro-2-methoxyphenyl)boronic acid|3,5-Difluoro-2-methoxyphenylboronic acid|3,5-Difluoro-2-methoxybenzeneboronic acid|ACMC-209orz|BORONICACID,97|GS-6319|KS-000026A0|(3,5-difluoro-2-methoxy-phenyl)boronic Acid|2-Methoxy-3,5-difluoro-benzeneboronic acid|Boronic acid, (3,5-difluoro-2-methoxyphenyl)-|(3,5-DIFLUORO-2-METHOXYPHENYL)BORONICACID|B-5327|2-METHOXY-3,5-DIFLUOROPHENYLBORONIC ACID|Boronic acid,B-(3,5-difluoro-2-methoxyphenyl)-|Bis[4-(2-hydroxyethoxy)-3,5-dibromophenyl]sulfone
| Molecular Formula | C7H7BF2O3 |
|---|---|
| Molecular Weight | 188.04562 g/mol |
| LogP | -0.3468 |
| Topological Polar Surface Area | 49.69 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 188.04562 |
| Monoisotopic Mass | 188.04562 |
| Heavy Atoms | 13 |
| Complexity | 316.8511 |
Chemical Identifiers
| CAS Number | 49540-00-3 |
|---|---|
| SMILES | B(C1=CC(=CC(=C1OC)F)F)(O)O |
Product Overview
3,5-Difluoro-2-methoxyphenylboronic acid (CAS 49540-00-3), with molecular formula C7H7BF2O3 and molecular weight 188.04562 g/mol. IUPAC: (3,5-difluoro-2-methoxyphenyl)boronic acid.
3,5-Difluoro-2-methoxyphenylboronic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »