(3,3-Diphenylpropyl)(3-(phenylthio)propyl)ammonium chloride
3,3-diphenyl-N-(3-phenylsulfanylpropyl)propan-1-amine;hydrochloride
Also Known As: EINECS 256-381-0|(3,3-Diphenylpropyl)(3-(phenylthio)propyl)ammonium chloride|(3,3-DIPHENYLPROPYL)[3-(PHENYLTHIO)PROPYL]AMMONIUM CHLORIDE|3,3-diphenyl-N-(3-phenylsulfanylpropyl)propan-1-amine hydrochloride|3,3-Diphenyl-N-[3-(phenylsulfanyl)propyl]propan-1-amine--hydrogen chloride (1/1)
| Molecular Formula | C24H28ClNS |
|---|---|
| Molecular Weight | 397.1631 g/mol |
| LogP | 6.4024 |
| Topological Polar Surface Area | 12.03 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Exact Mass | 397.1631 |
| Monoisotopic Mass | 397.1631 |
| Heavy Atoms | 27 |
| Complexity | 694.60266 |
Chemical Identifiers
| CAS Number | 49566-00-9 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(CCNCCCSC2=CC=CC=C2)C3=CC=CC=C3.Cl |
Product Overview
(3,3-Diphenylpropyl)(3-(phenylthio)propyl)ammonium chloride (CAS 49566-00-9), with molecular formula C24H28ClNS and molecular weight 397.1631 g/mol. IUPAC: 3,3-diphenyl-N-(3-phenylsulfanylpropyl)propan-1-amine;hydrochloride.
(3,3-Diphenylpropyl)(3-(phenylthio)propyl)ammonium chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »