N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)-2-oxochromene-3-carboxamide
N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)-2-oxochromene-3-carboxamide
Also Known As: AK-968/40734444|N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)-2-oxo-2H-chromene-3-carboxamide|N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)-2-oxochromene-3-carboxamide|N-(3-cyano-5-methyl-4-phenyl(2-thienyl))(2-oxochromen-3-yl)carboxamide|N-(3-cyano-5-methyl-4-phenyl-2-thienyl)-2-oxo-2H-chromene-3-carboxamide|N-(3-cyano-5-methyl-4-phenyl-thiophen-2-yl)-2-oxo-chromene-3-carboxamide
| Molecular Formula | C22H14N2O3S |
|---|---|
| Molecular Weight | 386.0725 g/mol |
| LogP | 4.9539 |
| Topological Polar Surface Area | 83.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Exact Mass | 386.0725 |
| Monoisotopic Mass | 386.0725 |
| Heavy Atoms | 28 |
| Complexity | 1297.1039 |
Chemical Identifiers
| CAS Number | 496017-48-2 |
|---|---|
| SMILES | CC1=C(C(=C(S1)NC(=O)C2=CC3=CC=CC=C3OC2=O)C#N)C4=CC=CC=C4 |
Product Overview
N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)-2-oxochromene-3-carboxamide (CAS 496017-48-2), with molecular formula C22H14N2O3S and molecular weight 386.0725 g/mol. IUPAC: N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)-2-oxochromene-3-carboxamide.
N-(3-cyano-5-methyl-4-phenylthiophen-2-yl)-2-oxochromene-3-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »