AC1O54US
ethane-1,2-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane
Also Known As: (C15-H22-N2-O2.C6-H10-O4.C2-H6-O2)x-|Adipic acid, ethylene glycol, 4,4'-dicyclohexylmethanediisocyanate polymer|Hexanedioic acid, polymer with 1,2-ethanediol and 1,1'-methylenebis[4-isocyanatocyclohexane]|Ethylene glycol, adipic acid, 4,4'-methylenebis(cyclohexylisocyanate)polymer|Ethane-1,2-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane|Ethylene glycol, adipic acid, 4,4'-methylenebis(cyclohexylisocyanate) polymer|ethane-1,2-diol; hexanedioic acid; 1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane|Hexanedioic acid, polymer with 1,2-ethanediol and 1,1'-methylenebis(4-isocyanatocyclohexane)
| Molecular Formula | C23H38N2O8 |
|---|---|
| Molecular Weight | 470.26282 g/mol |
| LogP | 2.8527 |
| Topological Polar Surface Area | 173.92 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Exact Mass | 470.26282 |
| Monoisotopic Mass | 470.26282 |
| Heavy Atoms | 33 |
| Complexity | 574.3726 |
Chemical Identifiers
| CAS Number | 49792-84-9 |
|---|---|
| SMILES | C1CC(CCC1CC2CCC(CC2)N=C=O)N=C=O.C(CCC(=O)O)CC(=O)O.C(CO)O |
Product Overview
AC1O54US (CAS 49792-84-9), with molecular formula C23H38N2O8 and molecular weight 470.26282 g/mol. IUPAC: ethane-1,2-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane.