ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate
ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate
Also Known As: ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate|Oprea1_272412|Oprea1_834459|KS-000025DR|GA-0859|BAS 03662618|J3.324.103H|AB00121060-01|SR-01000454882-1|A2622/0111565|ETHYL6-CHLORO-2,3,4,9-TETRAHYDRO-1H-CARBAZOLE-1-CARBOXYLATE|1H-Carbazole-1-carboxylicacid, 6-chloro-2,3,4,9-tetrahydro-, ethyl ester|6-Chloro-1,2,3,4-tetrahydro-9H-carbazole-1-carboxylic acid ethyl ester|6-chloro-1,2,3,4-tetrahydro-carbazole-1-carboxylic acid ethyl ester|6-Chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylic acid ethyl ester
| Molecular Formula | C15H16ClNO2 |
|---|---|
| Molecular Weight | 277.08694 g/mol |
| LogP | 3.8043 |
| Topological Polar Surface Area | 42.09 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 277.08694 |
| Monoisotopic Mass | 277.08694 |
| Heavy Atoms | 19 |
| Complexity | 632.3524 |
Chemical Identifiers
| CAS Number | 49844-36-2 |
|---|---|
| SMILES | CCOC(=O)C1CCCC2=C1NC3=C2C=C(C=C3)Cl |
Product Overview
ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate (CAS 49844-36-2), with molecular formula C15H16ClNO2 and molecular weight 277.08694 g/mol. IUPAC: ethyl 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate.