Phytyl acetate
[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] acetate
Also Known As: Phytyl acetate|Phytol acetate|Z-Phytyl acetate|(E)-Phytyl acetate|Phytyl acetate, (E)-|Teprenone Impurity 19|Phytyl acetate, (Z)-|TRANS-PHYTYL ACETATE|EINECS 233-565-9|(E,R,R)-PHYTYL ACETATE|(E,Z)-PHYTYL ACETATE|PHYTYL ACETATE [FHFI]|FEMA NO. 4197|FEMA NO. 4197, E-|FEMA No. 4197, Z-|2-Hexadecen-1-ol, 3,7,11,15-tetramethyl-, 1-acetate, (2E,7R,11R)-|(7R,11R,E)-3,7,11,15-Tetramethylhexadec-2-en-1-yl acetate|(7R,11R)-TRANS-PHYTOL ACETATE|Phytol, acetate, (7R,11R)-Z-|[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] acetate|2-Hexadecen-1-ol, 3,7,11,15-tetramethyl-, acetate, (2E,7R,11R)-|3,7,11,15-Tetramethyl-2-hexadecenyl Acetate|Phytyl Acetate (cis- and trans- mixture)|J2.891.223D
| Molecular Formula | C22H42O2 |
|---|---|
| Molecular Weight | 338.31848 g/mol |
| LogP | 8.8 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Exact Mass | 338.31848 |
| Monoisotopic Mass | 338.31848 |
| Heavy Atoms | 24 |
| Complexity | 344.0 |
Chemical Identifiers
| CAS Number | 5016-85-3 |
|---|---|
| SMILES | C[C@@H](CCC[C@@H](C)CCC/C(=C/COC(=O)C)/C)CCCC(C)C |
| InChIKey | JIGCTXHIECXYRJ-ILWBRPEASA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Phytyl acetate (CAS 5016-85-3), with molecular formula C22H42O2 and molecular weight 338.31848 g/mol. IUPAC: [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] acetate.