Ethyl 4-aminocinnamate
ethyl (E)-3-(4-aminophenyl)prop-2-enoate
Also Known As: Ethyl 4-aminocinnamate|Ethyl p-aminocinnamate|Ethyl 3-(4-aminophenyl)acrylate|(E)-Ethyl 4-aminocinnamate|4-aminocinnamic acid ethyl ester|Ethyl4-aminocinnamate|Ethyl trans-4-aminocinnamate|ethyl (E)-3-(4-aminophenyl)prop-2-enoate|Cinnamic acid, ethyl ester|ethyl 3-(4-aminophenyl)prop-2-enoate|ethyl (2E)-3-(4-aminophenyl)prop-2-enoate|(E)-ethyl 3-(4-aminophenyl)acrylate|ETHYL-4-AMINOCINNAMATE|EINECS 225-747-1|TRANS-3-(4-AMINOPHENYL)ACRYLATE ETHYL ESTER|2-Propenoic acid, ethyl ester|Ethyl 4-aminocinnamate, 97%|Cinnamic acid, p-amino-, ethyl ester|p-Aminocinnamic acid ethyl ester|AMY5113|2-Propenoic acid, 3-(4-aminophenyl)-, ethyl ester|ethyl (E)-3-(4-aminophenyl)acrylate|ethyl-(2e)-3-(4-aminophenyl)acrylat|ethyl (2E)-3-(4-aminophenyl)acrylate|CE-064|4-Aminobenzeneacrylic acid ethyl ester
| Molecular Formula | C11H13NO2 |
|---|---|
| Molecular Weight | 191.09464 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 52.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 191.09464 |
| Monoisotopic Mass | 191.09464 |
| Heavy Atoms | 14 |
| Complexity | 205.0 |
Chemical Identifiers
| CAS Number | 508-36-1 |
|---|---|
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)N |
| InChIKey | NRPMBSHHBFFYBF-VMPITWQZSA-N |
Patent-Derived Application Labels
Derived from 13 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl 4-aminocinnamate (CAS 508-36-1), with molecular formula C11H13NO2 and molecular weight 191.09464 g/mol. IUPAC: ethyl (E)-3-(4-aminophenyl)prop-2-enoate.