4-Methoxy-N,N,N-trimethylbenzeneethanaminium chloride
2-(4-methoxyphenyl)ethyl-trimethylazanium chloride
Also Known As: 4-Methoxy-N,N,N-trimethylbenzeneethanaminium chloride|Benzeneethanaminium, 4-methoxy-N,N,N-trimethyl-, chloride|(4-methoxy-phenethyl)-trimethyl-ammonium chloride|(4-methoxy-phenethyl)-trimethyl-ammonium; chloride|2-(4-methoxyphenyl)ethyl-trimethylazanium chloride|2-(4-Methoxyphenyl)-N,N,N-trimethylethan-1-aminium chloride
| Molecular Formula | C12H20ClNO |
|---|---|
| Molecular Weight | 229.12334 g/mol |
| LogP | -1.0521 |
| Topological Polar Surface Area | 9.23 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Exact Mass | 229.12334 |
| Monoisotopic Mass | 229.12334 |
| Heavy Atoms | 15 |
| Complexity | 276.66876 |
Chemical Identifiers
| CAS Number | 50822-99-6 |
|---|---|
| SMILES | C[N+](C)(C)CCC1=CC=C(C=C1)OC.[Cl-] |
Product Overview
4-Methoxy-N,N,N-trimethylbenzeneethanaminium chloride (CAS 50822-99-6), with molecular formula C12H20ClNO and molecular weight 229.12334 g/mol. IUPAC: 2-(4-methoxyphenyl)ethyl-trimethylazanium chloride.
4-Methoxy-N,N,N-trimethylbenzeneethanaminium chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »