![Ethyl 2-[(4-methoxyphenyl)amino]acetate structure](/static/products/508/50845-77-7.png)
Ethyl 2-[(4-methoxyphenyl)amino]acetate
ethyl 2-(4-methoxyanilino)acetate
Also Known As: ethyl 2-[(4-methoxyphenyl)amino]acetate|ethyl N-(4-methoxyphenyl)glycinate|Ethyl p-anisidinoacetate|ethyl 2-(4-methoxyanilino)acetate|Faropenem Impurity 1|ethyl [(4-methoxyphenyl)amino]acetate|ethyl (4-methoxyanilino)acetate|Oprea1_022919|N-(4-Methoxyphenyl)glycine ethyl ester|N-(p-Anisyl)glycine ethyl ester|TOS-BB-1237|Ethyl 2-((4-methoxyphenyl)amino)acetate|Glycine, N-(4-methoxyphenyl)-, ethyl ester|ethyl 2-(4-methoxyphenyl)aminoacetate|phenylglycine, p-methoxy- ethyl ester-|ethyl2-[(4-methoxyphenyl)amino]acetate|(4-Methoxyanilino)acetic acid ethyl ester|4-Methoxyphenylaminoacetic acid ethyl ester|2-(4-Methoxyanilino)acetic acid ethyl ester|BB 0221456|K-9384|F2183-0343
| Molecular Formula | C11H15NO3 |
|---|---|
| Molecular Weight | 209.1052 g/mol |
| LogP | 1.6702 |
| Topological Polar Surface Area | 47.56 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 209.1052 |
| Monoisotopic Mass | 209.1052 |
| Heavy Atoms | 15 |
| Complexity | 308.114 |
Chemical Identifiers
| CAS Number | 50845-77-7 |
|---|---|
| SMILES | CCOC(=O)CNC1=CC=C(C=C1)OC |
Product Overview
Ethyl 2-[(4-methoxyphenyl)amino]acetate (CAS 50845-77-7), with molecular formula C11H15NO3 and molecular weight 209.1052 g/mol. IUPAC: ethyl 2-(4-methoxyanilino)acetate.