N-bis(N-methylanilino)phosphoryl-N-methylaniline
N-bis(N-methylanilino)phosphoryl-N-methylaniline
Also Known As: N-bis(N-methylanilino)phosphoryl-N-methylaniline|SR-01000025313-1|Phosphoric triamide, N,N',N''-triphenyl-N,N',N''-trimethyl-,|T0400-4295|N,N',N''-Trimethyl-N,N',N''-triphenylphosphoric triamide|Phosphoric triamide, N,N',N''-trimethyl-N,N',N''-triphenyl-|Phosphoric triamide, N,N inverted exclamation mark(R),N inverted exclamation mark(R) inverted exclamation mark(R)-trimethyl-N,N inverted exclamation mark(R),N inverted exclamation mark(R) inverted exclamation mark(R)-triphenyl-
| Molecular Formula | C21H24N3OP |
|---|---|
| Molecular Weight | 365.1657 g/mol |
| LogP | 5.4 |
| Topological Polar Surface Area | 26.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 365.1657 |
| Monoisotopic Mass | 365.1657 |
| Heavy Atoms | 26 |
| Complexity | 401.0 |
Chemical Identifiers
| CAS Number | 50869-79-9 |
|---|---|
| SMILES | CN(C1=CC=CC=C1)P(=O)(N(C)C2=CC=CC=C2)N(C)C3=CC=CC=C3 |
| InChIKey | SXDAZEJYDNATRB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N-bis(N-methylanilino)phosphoryl-N-methylaniline (CAS 50869-79-9), with molecular formula C21H24N3OP and molecular weight 365.1657 g/mol. IUPAC: N-bis(N-methylanilino)phosphoryl-N-methylaniline.