4a,7-Ethano-4aH-naphth[1,8a-b]oxirene, octahydro-4,4,7-trimethyl-
2,2,9-trimethyl-6-oxatetracyclo[7.2.2.01,7.05,7]tridecane
Also Known As: Octahydro-4,4,7-trimethyl-4a,7-ethano-4aH-naphth(1,8a-b)oxirene|4a,7-Ethano-4aH-naphth[1,8a-b]oxirene, octahydro-4,4,7-trimethyl-|Octahydro-4,4,7-trimethyl-4a,7-ethano-4aH-naphth[1,8a-b]oxirene|4a,7-Ethano-4aH-naphth(1,8a-b)oxirene, octahydro-4,4,7-trimethyl-|2,2,9-trimethyl-6-oxatetracyclo[7.2.2.01,7.05,7]tridecane|4,4,7-Trimethyloctahydro-4a,7-ethanonaphtho[1,8a-b]oxirene|octahydro - 4,4,7 - trimethyl - 4a,7 - ethano - 4aH - naphth(1,8a - b)oxirene|256-991-7
| Molecular Formula | C15H24O |
|---|---|
| Molecular Weight | 220.18271 g/mol |
| LogP | 4.0 |
| Topological Polar Surface Area | 12.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 220.18271 |
| Monoisotopic Mass | 220.18271 |
| Heavy Atoms | 16 |
| Complexity | 348.0 |
Chemical Identifiers
| CAS Number | 51115-88-9 |
|---|---|
| SMILES | CC1(CCC2C3(C14CCC(C3)(CC4)C)O2)C |
| InChIKey | KGWCEBVNLVTVQH-UHFFFAOYSA-N |
Product Overview
4a,7-Ethano-4aH-naphth[1,8a-b]oxirene, octahydro-4,4,7-trimethyl- (CAS 51115-88-9), with molecular formula C15H24O and molecular weight 220.18271 g/mol. IUPAC: 2,2,9-trimethyl-6-oxatetracyclo[7.2.2.01,7.05,7]tridecane.