Neryl 2-methylbutanoate
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate
Also Known As: Neryl 2-methylbutyrate|neryl 2-methylbutanoate|Neryl 2-methyl butyrate|EINECS 256-994-3|(Z)-3,7-Dimethylocta-2,6-dienyl 2-methylbutyrate|[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate|(Z)-3,7-Dimethylocta-2,6-dien-1-yl 2-methylbutanoate|Butanoic acid, 2-methyl-, (2Z)-3,7-dimethyl-2,6-octadien-1-yl ester|(2Z)-3,7-DIMETHYLOCTA-2,6-DIEN-1-YL 2-METHYLBUTANOATE|Butanoic acid, 2-methyl-, (2Z)-3,7-dimethyl-2,6-octadienyl ester|Butanoic acid, 2-methyl-, 3,7-dimethyl-2,6-octadienyl ester, (Z)-|2-Methylbutanoic acid (Z)-3,7-dimethyl-2,6-octadienyl ester|256-994-3
| Molecular Formula | C15H26O2 |
|---|---|
| Molecular Weight | 238.19328 g/mol |
| LogP | 4.2684 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Exact Mass | 238.19328 |
| Monoisotopic Mass | 238.19328 |
| Heavy Atoms | 17 |
| Complexity | 283.29694 |
Chemical Identifiers
| CAS Number | 51117-19-2 |
|---|---|
| SMILES | CCC(C)C(=O)OC/C=C(/C)\CCC=C(C)C |
Product Overview
Neryl 2-methylbutanoate (CAS 51117-19-2), with molecular formula C15H26O2 and molecular weight 238.19328 g/mol. IUPAC: [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate.