Dibenzyl phosphoramidate
[amino(phenylmethoxy)phosphoryl]oxymethylbenzene
Also Known As: dibenzyl phosphoramidate|dibenzylphosphoramidate|dibenzyl amidophosphate|Phosphoramidic acid, dibenzyl ester|Amidophosphorsaeure-dibenzylester|Phosporamidic acid dibenzyl ester|[amino(phenylmethoxy)phosphoryl]oxymethylbenzene|Amidophosphoric acid dibenzyl ester|Phosphoramidic acid, bis(phenylmethyl) ester|Phosphoramidicacid,bis(phenylmethyl)ester|[amino(benzyloxy)phosphoryl]oxymethylbenzene|({[AMINO(BENZYLOXY)PHOSPHORYL]OXY}METHYL)BENZENE|J1.195.775G|636-793-0
| Molecular Formula | C14H16NO3P |
|---|---|
| Molecular Weight | 277.0868 g/mol |
| LogP | 1.7 |
| Topological Polar Surface Area | 61.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 277.0868 |
| Monoisotopic Mass | 277.0868 |
| Heavy Atoms | 19 |
| Complexity | 273.0 |
Chemical Identifiers
| CAS Number | 51131-68-1 |
|---|---|
| SMILES | C1=CC=C(C=C1)COP(=O)(N)OCC2=CC=CC=C2 |
| InChIKey | HSNUXDIQZKIQRR-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 9 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Dibenzyl phosphoramidate (CAS 51131-68-1), with molecular formula C14H16NO3P and molecular weight 277.0868 g/mol. IUPAC: [amino(phenylmethoxy)phosphoryl]oxymethylbenzene.