2,4-D Methylamine salt
2-(2,4-dichlorophenoxy)acetic acid;methanamine
Also Known As: 2,4-D methylamine salt|2,4-d Methylammonium|Caswell No. 315W|2,4-D METHYLAMINE|EINECS 257-030-4|EPA Pesticide Chemical Code 030027|2,4-D, methylamine salt (1:1)|Methylammonium (o,p-dichlorophenoxy)acetate|2,4-Dichlorophenoxyacetic acid methylamine salt|2-(2,4-dichlorophenoxy)acetic acid,methanamine|Acetic acid, (2,4-dichlorophenoxy)-, compd. with methanamine (1:1)|2-(2,4-dichlorophenoxy)acetic acid; methanamine|METHANAMINE, (2,4-DICHLOROPHENOXY)ACETATE|(2,4-Dichlorophenoxy)acetic acid--methanamine (1/1)|ACETIC ACID, 2-(2,4-DICHLOROPHENOXY)-, COMPD. WITH METHANAMINE (1:1)|257-030-4
| Molecular Formula | C9H11Cl2NO3 |
|---|---|
| Molecular Weight | 251.0116 g/mol |
| LogP | 2.0317 |
| Topological Polar Surface Area | 72.55 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 251.0116 |
| Monoisotopic Mass | 251.0116 |
| Heavy Atoms | 15 |
| Complexity | 331.13354 |
Chemical Identifiers
| CAS Number | 51173-63-8 |
|---|---|
| SMILES | CN.C1=CC(=C(C=C1Cl)Cl)OCC(=O)O |
Product Overview
2,4-D Methylamine salt (CAS 51173-63-8), with molecular formula C9H11Cl2NO3 and molecular weight 251.0116 g/mol. IUPAC: 2-(2,4-dichlorophenoxy)acetic acid;methanamine.