3-(Triphenylphosphoranyl)propanenitrile
2-cyanoethyl(triphenyl)phosphanium
Also Known As: 3-(Triphenylphosphoranyl)propanenitrile|(2-Cyanoethyl)triphenylphosphonium|bis(phenylsulfanylmethyl)mercury|(2-Cyanoethyl)triphenylphosphonium ion|Phosphonium, (2-cyanoethyl)triphenyl-|(2-cyanoethyl)triphenylphosphanium|2-cyanoethyl(triphenyl)phosphanium|2-cyanoethyl(triphenyl)phosphonium|(2-Cyanoethyl)triphenylphosphonium cation|Triphenyl(2-cyanoethyl)phosphonium|(2-cyanoethyl)(triphenyl)phosphonium|(2-Cyanoethyl)tri(phenyl)phosphanium|J1.178.557C
| Molecular Formula | C21H19NP+ |
|---|---|
| Molecular Weight | 316.12552 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 23.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Exact Mass | 316.12552 |
| Monoisotopic Mass | 316.12552 |
| Heavy Atoms | 23 |
| Complexity | 346.0 |
Chemical Identifiers
| CAS Number | 51353-57-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)[P+](CCC#N)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChIKey | HYCVQYHHNVYMQK-UHFFFAOYSA-N |
Product Overview
3-(Triphenylphosphoranyl)propanenitrile (CAS 51353-57-2), with molecular formula C21H19NP+ and molecular weight 316.12552 g/mol. IUPAC: 2-cyanoethyl(triphenyl)phosphanium.
3-(Triphenylphosphoranyl)propanenitrile is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »