Norethisterone enanthate
[(8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] heptanoate
Also Known As: Norethisterone enanthate|Noristerat|Norigest|NORETHINDRONE ENANTHATE|Norethisterone enantate|Norlutin enanthate|Sovel|Norethisterone oenanthate|Noristerat (TN)|norethisterone heptanoate|norethindrone heptanoate|norethisterone-enanthate|norethisterone enantate;|19-norethindrone enanthate|SH 393|EINECS 223-326-7|ZK-5410|LG 202|HY-A0285|Tox21_113027|s6589|17alpha-Ethynyl-19-nortestosterone enanthate|AC-6835
| Molecular Formula | C27H38O3 |
|---|---|
| Molecular Weight | 410.2821 g/mol |
| LogP | 6.0 |
| Topological Polar Surface Area | 43.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Exact Mass | 410.2821 |
| Monoisotopic Mass | 410.2821 |
| Heavy Atoms | 30 |
| Complexity | 770.0 |
Chemical Identifiers
| CAS Number | 51575-27-0 |
|---|---|
| SMILES | CCCCCCC(=O)O[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@H]34)C)C#C |
| InChIKey | APTGJECXMIKIET-WOSSHHRXSA-N |
Patent-Derived Application Labels
Derived from 5 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Norethisterone enanthate (CAS 51575-27-0), with molecular formula C27H38O3 and molecular weight 410.2821 g/mol. IUPAC: [(8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] heptanoate.