1-{1-[4-(dimethylamino)phenyl]-5-hydroxy-2-methyl-1H-indol-3-yl}ethanone
1-[1-[4-(dimethylamino)phenyl]-5-hydroxy-2-methylindol-3-yl]ethanone
Also Known As: CBMicro_026882|BAS 00796045|BIM-0026963.P001|AH-262/01731044|SR-01000454843-1|1-{1-[4-(dimethylamino)phenyl]-5-hydroxy-2-methyl-1H-indol-3-yl}ethanone|3-acetyl-1-[4-(dimethylamino)phenyl]-5-hydroxy-2-methylindole|1-[1-(4-dimethylaminophenyl)-5-hydroxy-2-methylindol-3-yl]ethanone|1-(1-(4-(dimethylamino)phenyl)-5-hydroxy-2-methyl-1H-indol-3-yl)ethanone|1-[1-(4-Dimethylamino-phenyl)-5-hydroxy-2-methyl-1H-indol-3-yl]-ethanone
| Molecular Formula | C19H20N2O2 |
|---|---|
| Molecular Weight | 308.15247 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 45.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 308.15247 |
| Monoisotopic Mass | 308.15247 |
| Heavy Atoms | 23 |
| Complexity | 431.0 |
Chemical Identifiers
| CAS Number | 5165-66-2 |
|---|---|
| SMILES | CC1=C(C2=C(N1C3=CC=C(C=C3)N(C)C)C=CC(=C2)O)C(=O)C |
| InChIKey | HWSYVNMDBAVEJG-UHFFFAOYSA-N |
Product Overview
1-{1-[4-(dimethylamino)phenyl]-5-hydroxy-2-methyl-1H-indol-3-yl}ethanone (CAS 5165-66-2), with molecular formula C19H20N2O2 and molecular weight 308.15247 g/mol. IUPAC: 1-[1-[4-(dimethylamino)phenyl]-5-hydroxy-2-methylindol-3-yl]ethanone.
1-{1-[4-(dimethylamino)phenyl]-5-hydroxy-2-methyl-1H-indol-3-yl}ethanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »