1-(Furan-2-ylmethyl)-4-naphthalen-2-ylsulfonylpiperazine
1-(furan-2-ylmethyl)-4-naphthalen-2-ylsulfonylpiperazine
Also Known As: Oprea1_745664|Oprea1_760428|BAS 03152367|1-(furan-2-ylmethyl)-4-naphthalen-2-ylsulfonylpiperazine|4-(2-furylmethyl)-1-(2-naphthylsulfonyl)piperazine|1-(2-FURYLMETHYL)-4-(2-NAPHTHYLSULFONYL)PIPERAZINE|1-(furan-2-ylmethyl)-4-(naphthalen-2-ylsulfonyl)piperazine|1-Furan-2-ylmethyl-4-(naphthalene-2-sulfonyl)-piperazine|1-(FURAN-2-YLMETHYL)-4-(NAPHTHALENE-2-SULFONYL)PIPERAZINE
| Molecular Formula | C19H20N2O3S |
|---|---|
| Molecular Weight | 356.11948 g/mol |
| LogP | 2.9393 |
| Topological Polar Surface Area | 53.76 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 356.11948 |
| Monoisotopic Mass | 356.11948 |
| Heavy Atoms | 25 |
| Complexity | 959.2626 |
Chemical Identifiers
| CAS Number | 519005-23-3 |
|---|---|
| SMILES | C1CN(CCN1CC2=CC=CO2)S(=O)(=O)C3=CC4=CC=CC=C4C=C3 |
Product Overview
1-(Furan-2-ylmethyl)-4-naphthalen-2-ylsulfonylpiperazine (CAS 519005-23-3), with molecular formula C19H20N2O3S and molecular weight 356.11948 g/mol. IUPAC: 1-(furan-2-ylmethyl)-4-naphthalen-2-ylsulfonylpiperazine.
1-(Furan-2-ylmethyl)-4-naphthalen-2-ylsulfonylpiperazine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »