AC1O55PP
(E)-but-2-enedioic acid;1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;propane-1,2-diol
Also Known As: (C9-H4-Cl6-O4.C4-H4-O4.C3-H8-O2)x-|(E)-but-2-enedioic acid; 1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylic acid; propane-1,2-diol|Bicyclo(2.2.1)hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-, polymer with (2E)-2-butenedioic acid and 1,2-propanediol|Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-, polymer with (2E)-2-butenedioic acid and 1,2-propanediol|Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 1,4,5,6,7,7-hexachloro-, polymer with (E)-2-butenedioic acid and 1,2-propanediol
| Molecular Formula | C16H16Cl6O10 |
|---|---|
| Molecular Weight | 577.88745 g/mol |
| LogP | 2.3048 |
| Topological Polar Surface Area | 189.66 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 577.88745 |
| Monoisotopic Mass | 579.8845 |
| Heavy Atoms | 32 |
| Complexity | 781.1659 |
Chemical Identifiers
| CAS Number | 52182-13-5 |
|---|---|
| SMILES | CC(CO)O.C(=C/C(=O)O)\C(=O)O.C1(C(C2(C(=C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C(=O)O)C(=O)O |
Product Overview
AC1O55PP (CAS 52182-13-5), with molecular formula C16H16Cl6O10 and molecular weight 577.88745 g/mol. IUPAC: (E)-but-2-enedioic acid;1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;propane-1,2-diol.