![Ethanone, 2-[(furan-2-ylmethyl)amino]-1-(phenothiazin-10-yl)- structure](/static/products/5226/522652-67-1.webp)
Ethanone, 2-[(furan-2-ylmethyl)amino]-1-(phenothiazin-10-yl)-
2-(furan-2-ylmethylamino)-1-phenothiazin-10-ylethanone
Also Known As: Ethanone, 2-[(furan-2-ylmethyl)amino]-1-(phenothiazin-10-yl)-|2-(furan-2-ylmethylamino)-1-phenothiazin-10-ylethanone|2-[(furan-2-ylmethyl)amino]-1-(10H-phenothiazin-10-yl)ethanone|2-[(2-furylmethyl)amino]-1-phenothiazin-10-ylethan-1-one|2-((furan-2-ylmethyl)amino)-1-(10H-phenothiazin-10-yl)ethanone|2-[(2-FURYLMETHYL)AMINO]-1-(10H-PHENOTHIAZIN-10-YL)-1-ETHANONE
| Molecular Formula | C19H16N2O2S |
|---|---|
| Molecular Weight | 336.09326 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 70.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 336.09326 |
| Monoisotopic Mass | 336.09326 |
| Heavy Atoms | 24 |
| Complexity | 425.0 |
Chemical Identifiers
| CAS Number | 522652-67-1 |
|---|---|
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)C(=O)CNCC4=CC=CO4 |
| InChIKey | DOUHTDLISGTWIG-UHFFFAOYSA-N |
Product Overview
Ethanone, 2-[(furan-2-ylmethyl)amino]-1-(phenothiazin-10-yl)- (CAS 522652-67-1), with molecular formula C19H16N2O2S and molecular weight 336.09326 g/mol. IUPAC: 2-(furan-2-ylmethylamino)-1-phenothiazin-10-ylethanone.
Ethanone, 2-[(furan-2-ylmethyl)amino]-1-(phenothiazin-10-yl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »