Etocrylene
ethyl 2-cyano-3,3-diphenylprop-2-enoate
Also Known As: Etocrylene|Etocrilene|Ethyl 2-cyano-3,3-diphenylacrylate|UV Absorber-2|Etocrileno|Etocrilenum|Uvinul N 35|Etocrylene [USAN]|Etocrilene [INN]|Etocrilene (INN)|Etocrylene (USAN)|UV Absorber2|Etocrilenum [INN-Latin]|Etocrileno [INN-Spanish]|Uvinul N35|CE 2|Uvinul N-35|USAF A-15972|2-Cyano-3,3-diphenylacrylic acid ethyl ester|ETOCRYLENE [HSDB]|ACMC-209kyr|Ethyl (diphenylmethylene)cyanoacetate|Etocrilenum (INN-Latin)|ETOCRYLENE [INCI]|Etocrileno (INN-Spanish)|ethyl 2-cyano-3,3-diphenylprop-2-enoate|2-Propenoic acid, 2-cyano-3,3-diphenyl-, ethyl ester|EINECS 226-029-0|Ethyl 2-cyano-3,3-diphenyl-2-propenoate|Ethyl 2cyano3,3diphenylacrylate
| Molecular Formula | C18H15NO2 |
|---|---|
| Molecular Weight | 277.1103 g/mol |
| LogP | 4.4 |
| Topological Polar Surface Area | 50.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 277.1103 |
| Monoisotopic Mass | 277.1103 |
| Heavy Atoms | 21 |
| Complexity | 411.0 |
Chemical Identifiers
| CAS Number | 5232-99-5 |
|---|---|
| SMILES | CCOC(=O)C(=C(C1=CC=CC=C1)C2=CC=CC=C2)C#N |
| InChIKey | IAJNXBNRYMEYAZ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 22 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Etocrylene (CAS 5232-99-5), with molecular formula C18H15NO2 and molecular weight 277.1103 g/mol. IUPAC: ethyl 2-cyano-3,3-diphenylprop-2-enoate.