2-(2-Nitrophenyl)-3,1-benzoxazin-4-one
2-(2-nitrophenyl)-3,1-benzoxazin-4-one
Also Known As: CBMicro_014967|2-(2-nitrophenyl)-3,1-benzoxazin-4-one|Oprea1_056273|Oprea1_217040|2-(2-nitrophenyl)-4H-3,1-benzoxazin-4-one|2-(2-Nitrophenyl)-4H-benzo[d][1,3]oxazin-4-one|2-(2-Nitro-phenyl)-benzo[d][1,3]oxazin-4-one|BAS 00333160|BIM-0014760.P001|J1.227.695H|2-(2-Nitrophenyl)-4H-3,1-benzoxazine-4-one|2-(2'-Nitrophenyl)-4,5-benz-1,3-oxazin-6-one|2-(2-Nitrophenyl)-4H-3,1-benzoxazin-4-one (9)|SR-01000421822-1|9-(2-nitrophenyl)-8-oxa-10-azabicyclo[4.4.0]deca-1,3,5,9-tetraen-7-one
| Molecular Formula | C14H8N2O4 |
|---|---|
| Molecular Weight | 268.0484 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 84.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 268.0484 |
| Monoisotopic Mass | 268.0484 |
| Heavy Atoms | 20 |
| Complexity | 443.0 |
Chemical Identifiers
| CAS Number | 5233-45-4 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=O)OC(=N2)C3=CC=CC=C3[N+](=O)[O-] |
| InChIKey | DWCFIKGNUJGZBZ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(2-Nitrophenyl)-3,1-benzoxazin-4-one (CAS 5233-45-4), with molecular formula C14H8N2O4 and molecular weight 268.0484 g/mol. IUPAC: 2-(2-nitrophenyl)-3,1-benzoxazin-4-one.