((1)-(4-Amino-2-hydroxy-4-oxobutyl)trimethylammonium) chloride
(5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride
Also Known As: DL-Carnitinamide hydrochloride|Piperidine,1-methyl-4-propyl|EINECS 226-073-0|EC 226-073-0|((+-)-(4-Amino-2-hydroxy-4-oxobutyl)trimethylammonium) chloride|((1)-(4-Amino-2-hydroxy-4-oxobutyl)trimethylammonium) chloride|(5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium;chloride|(5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride|4-Amino-2-hydroxy-N,N,N-trimethyl-4-oxo-1-butanaminium chloride|1-Butanaminium,4-amino-2-hydroxy-N,N,N-trimethyl-4-oxo-, chloride (1:1)
| Molecular Formula | C7H15ClN2O2 |
|---|---|
| Molecular Weight | 194.0822 g/mol |
| LogP | -4.0403 |
| Topological Polar Surface Area | 66.33 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 194.0822 |
| Monoisotopic Mass | 194.0822 |
| Heavy Atoms | 12 |
| Complexity | 166.7893 |
Chemical Identifiers
| CAS Number | 5261-99-4 |
|---|---|
| SMILES | C[N+](=CCC(CC(=O)N)O)C.[Cl-] |
Product Overview
((1)-(4-Amino-2-hydroxy-4-oxobutyl)trimethylammonium) chloride (CAS 5261-99-4), with molecular formula C7H15ClN2O2 and molecular weight 194.0822 g/mol. IUPAC: (5-amino-3-hydroxy-5-oxopentylidene)-dimethylazanium chloride.